C22H22FNO4 — CID 143225836
ethyl 3-(1-benzoyl-4-fluoro-5-methoxy-2-methylindol-3-yl)propanoate (PubChem CID 143225836) has the molecular formula C22H22FNO4 and a molecular weight of 383.42 g/mol. Its IUPAC name is ethyl 3-(1-benzoyl-4-fluoro-5-methoxy-2-methylindol-3-yl)propanoate.
| Compound Name | ethyl 3-(1-benzoyl-4-fluoro-5-methoxy-2-methylindol-3-yl)propanoate |
|---|---|
| PubChem CID | 143225836 |
| Molecular Formula | C22H22FNO4 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | ethyl 3-(1-benzoyl-4-fluoro-5-methoxy-2-methylindol-3-yl)propanoate |
| SMILES | CCOC(=O)CCc1c(C)n(C(=O)c2ccccc2)c2ccc(OC)c(F)c12 |
| InChI | InChI=1S/C22H22FNO4/c1-4-28-19(25)13-10-16-14(2)24(22(26)15-8-6-5-7-9-15)17-11-12-18(27-3)21(23)20(16)17/h5-9,11-12H,4,10,13H2,1-3H3 |
| InChIKey | DRTZXIOQRNJXAZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |