C24H25NO6 — CID 18995222
ethyl 4-[5-methoxy-1-(4-methoxybenzoyl)-2-methylindol-3-yl]-2-oxobutanoate (PubChem CID 18995222) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is ethyl 4-[5-methoxy-1-(4-methoxybenzoyl)-2-methylindol-3-yl]-2-oxobutanoate.
| Compound Name | ethyl 4-[5-methoxy-1-(4-methoxybenzoyl)-2-methylindol-3-yl]-2-oxobutanoate |
|---|---|
| PubChem CID | 18995222 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | ethyl 4-[5-methoxy-1-(4-methoxybenzoyl)-2-methylindol-3-yl]-2-oxobutanoate |
| SMILES | CCOC(=O)C(=O)CCc1c(C)n(C(=O)c2ccc(OC)cc2)c2ccc(OC)cc12 |
| InChI | InChI=1S/C24H25NO6/c1-5-31-24(28)22(26)13-11-19-15(2)25(21-12-10-18(30-4)14-20(19)21)23(27)16-6-8-17(29-3)9-7-16/h6-10,12,14H,5,11,13H2,1-4H3 |
| InChIKey | YWCDVSBJWRMICE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|