C27H25NO5 — CID 18995255
ethyl 4-[5-methoxy-2-methyl-1-(naphthalene-2-carbonyl)indol-3-yl]-3-oxobutanoate (PubChem CID 18995255) has the molecular formula C27H25NO5 and a molecular weight of 443.50 g/mol. Its IUPAC name is ethyl 4-[5-methoxy-2-methyl-1-(naphthalene-2-carbonyl)indol-3-yl]-3-oxobutanoate.
| Compound Name | ethyl 4-[5-methoxy-2-methyl-1-(naphthalene-2-carbonyl)indol-3-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 18995255 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | ethyl 4-[5-methoxy-2-methyl-1-(naphthalene-2-carbonyl)indol-3-yl]-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)Cc1c(C)n(C(=O)c2ccc3ccccc3c2)c2ccc(OC)cc12 |
| InChI | InChI=1S/C27H25NO5/c1-4-33-26(30)15-21(29)14-23-17(2)28(25-12-11-22(32-3)16-24(23)25)27(31)20-10-9-18-7-5-6-8-19(18)13-20/h5-13,16H,4,14-15H2,1-3H3 |
| InChIKey | IVCVBLMZDIEPNP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|