C25H32N2O2 — CID 21313355
[3-[2-[di(propan-2-yl)amino]ethyl]-5-methoxy-2-methylindol-1-yl]-phenylmethanone (PubChem CID 21313355) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is [3-[2-[di(propan-2-yl)amino]ethyl]-5-methoxy-2-methylindol-1-yl]-phenylmethanone.
| Compound Name | [3-[2-[di(propan-2-yl)amino]ethyl]-5-methoxy-2-methylindol-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 21313355 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | [3-[2-[di(propan-2-yl)amino]ethyl]-5-methoxy-2-methylindol-1-yl]-phenylmethanone |
| SMILES | COc1ccc2c(c1)c(CCN(C(C)C)C(C)C)c(C)n2C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H32N2O2/c1-17(2)26(18(3)4)15-14-22-19(5)27(25(28)20-10-8-7-9-11-20)24-13-12-21(29-6)16-23(22)24/h7-13,16-18H,14-15H2,1-6H3 |
| InChIKey | YAODBKTYHZMIDS-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |