C14H20N4O2 — CID 174117212
3-(4,7-diamino-1,2-dimethylindol-3-yl)-2-(methylamino)propanoic acid (PubChem CID 174117212) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-(4,7-diamino-1,2-dimethylindol-3-yl)-2-(methylamino)propanoic acid.
| Compound Name | 3-(4,7-diamino-1,2-dimethylindol-3-yl)-2-(methylamino)propanoic acid |
|---|---|
| PubChem CID | 174117212 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3-(4,7-diamino-1,2-dimethylindol-3-yl)-2-(methylamino)propanoic acid |
| SMILES | CNC(Cc1c(C)n(C)c2c(N)ccc(N)c12)C(=O)O |
| InChI | InChI=1S/C14H20N4O2/c1-7-8(6-11(17-2)14(19)20)12-9(15)4-5-10(16)13(12)18(7)3/h4-5,11,17H,6,15-16H2,1-3H3,(H,19,20) |
| InChIKey | CRQSQETYYCQCOR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|