C13H14FN3O4 — CID 122473821
2-amino-3-(7-fluoro-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid (PubChem CID 122473821) has the molecular formula C13H14FN3O4 and a molecular weight of 295.27 g/mol. Its IUPAC name is 2-amino-3-(7-fluoro-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid.
| Compound Name | 2-amino-3-(7-fluoro-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 122473821 |
| Molecular Formula | C13H14FN3O4 |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-amino-3-(7-fluoro-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid |
| SMILES | Cc1c(CC(N)C(=O)O)c2c([N+](=O)[O-])ccc(F)c2n1C |
| InChI | InChI=1S/C13H14FN3O4/c1-6-7(5-9(15)13(18)19)11-10(17(20)21)4-3-8(14)12(11)16(6)2/h3-4,9H,5,15H2,1-2H3,(H,18,19) |
| InChIKey | YJSGAXQCXVZZKN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|