C36H38F3N7O8 — CID 157449726
bis(2-amino-3-(4-fluoro-1-methylindol-3-yl)propanoic acid);2-amino-3-(4-fluoro-1-methyl-7-nitroindol-3-yl)propanoic acid (PubChem CID 157449726) has the molecular formula C36H38F3N7O8 and a molecular weight of 753.74 g/mol. Its IUPAC name is bis(2-amino-3-(4-fluoro-1-methylindol-3-yl)propanoic acid);2-amino-3-(4-fluoro-1-methyl-7-nitroindol-3-yl)propanoic acid.
| Compound Name | bis(2-amino-3-(4-fluoro-1-methylindol-3-yl)propanoic acid);2-amino-3-(4-fluoro-1-methyl-7-nitroindol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 157449726 |
| Molecular Formula | C36H38F3N7O8 |
| Molecular Weight | 753.74 g/mol |
| Exact Mass | 753.27 |
| IUPAC Name | bis(2-amino-3-(4-fluoro-1-methylindol-3-yl)propanoic acid);2-amino-3-(4-fluoro-1-methyl-7-nitroindol-3-yl)propanoic acid |
| SMILES | Cn1cc(CC(N)C(=O)O)c2c(F)ccc([N+](=O)[O-])c21.Cn1cc(CC(N)C(=O)O)c2c(F)cccc21.Cn1cc(CC(N)C(=O)O)c2c(F)cccc21 |
| InChI | InChI=1S/C12H12FN3O4.2C12H13FN2O2/c1-15-5-6(4-8(14)12(17)18)10-7(13)2-3-9(11(10)15)16(19)20;2*1-15-6-7(5-9(14)12(16)17)11-8(13)3-2-4-10(11)15/h2-3,5,8H,4,14H2,1H3,(H,17,18);2*2-4,6,9H,5,14H2,1H3,(H,16,17) |
| InChIKey | BSQRESTWDJGRKE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 247.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.74 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|