C39H42N6O6 — CID 158729543
2-amino-3-(6-ethenyl-1-methylindol-3-yl)propanoic acid;2-amino-3-(6-ethenyl-1-methyl-4-nitroindol-3-yl)propanoic acid;6-ethenyl-1-methylindole (PubChem CID 158729543) has the molecular formula C39H42N6O6 and a molecular weight of 690.80 g/mol. Its IUPAC name is 2-amino-3-(6-ethenyl-1-methylindol-3-yl)propanoic acid;2-amino-3-(6-ethenyl-1-methyl-4-nitroindol-3-yl)propanoic acid;6-ethenyl-1-methylindole.
| Compound Name | 2-amino-3-(6-ethenyl-1-methylindol-3-yl)propanoic acid;2-amino-3-(6-ethenyl-1-methyl-4-nitroindol-3-yl)propanoic acid;6-ethenyl-1-methylindole |
|---|---|
| PubChem CID | 158729543 |
| Molecular Formula | C39H42N6O6 |
| Molecular Weight | 690.80 g/mol |
| Exact Mass | 690.32 |
| IUPAC Name | 2-amino-3-(6-ethenyl-1-methylindol-3-yl)propanoic acid;2-amino-3-(6-ethenyl-1-methyl-4-nitroindol-3-yl)propanoic acid;6-ethenyl-1-methylindole |
| SMILES | C=Cc1cc([N+](=O)[O-])c2c(CC(N)C(=O)O)cn(C)c2c1.C=Cc1ccc2c(CC(N)C(=O)O)cn(C)c2c1.C=Cc1ccc2ccn(C)c2c1 |
| InChI | InChI=1S/C14H15N3O4.C14H16N2O2.C11H11N/c1-3-8-4-11-13(12(5-8)17(20)21)9(7-16(11)2)6-10(15)14(18)19;1-3-9-4-5-11-10(7-12(15)14(17)18)8-16(2)13(11)6-9;1-3-9-4-5-10-6-7-12(2)11(10)8-9/h3-5,7,10H,1,6,15H2,2H3,(H,18,19);3-6,8,12H,1,7,15H2,2H3,(H,17,18);3-8H,1H2,2H3 |
| InChIKey | IKXOPKQFBBAGEG-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 184.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.80 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|