C15H17N3O4 — CID 122473844
2-amino-3-(6-cyclopropyl-1-methyl-4-nitroindol-3-yl)propanoic acid (PubChem CID 122473844) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-amino-3-(6-cyclopropyl-1-methyl-4-nitroindol-3-yl)propanoic acid.
| Compound Name | 2-amino-3-(6-cyclopropyl-1-methyl-4-nitroindol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 122473844 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-amino-3-(6-cyclopropyl-1-methyl-4-nitroindol-3-yl)propanoic acid |
| SMILES | Cn1cc(CC(N)C(=O)O)c2c([N+](=O)[O-])cc(C3CC3)cc21 |
| InChI | InChI=1S/C15H17N3O4/c1-17-7-10(4-11(16)15(19)20)14-12(17)5-9(8-2-3-8)6-13(14)18(21)22/h5-8,11H,2-4,16H2,1H3,(H,19,20) |
| InChIKey | BEYFNEAYRLFELD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|