C11H11N3O5 — CID 122473679
(2S)-2-amino-3-(6-hydroxy-4-nitro-1H-indol-3-yl)propanoic acid (PubChem CID 122473679) has the molecular formula C11H11N3O5 and a molecular weight of 265.23 g/mol. Its IUPAC name is (2S)-2-amino-3-(6-hydroxy-4-nitro-1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(6-hydroxy-4-nitro-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 122473679 |
| Molecular Formula | C11H11N3O5 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | (2S)-2-amino-3-(6-hydroxy-4-nitro-1H-indol-3-yl)propanoic acid |
| SMILES | N[C@@H](Cc1c[nH]c2cc(O)cc([N+](=O)[O-])c12)C(=O)O |
| InChI | InChI=1S/C11H11N3O5/c12-7(11(16)17)1-5-4-13-8-2-6(15)3-9(10(5)8)14(18)19/h2-4,7,13,15H,1,12H2,(H,16,17)/t7-/m0/s1 |
| InChIKey | DEAGQJJUSCWJFV-ZETCQYMHSA-N |
| XLogP | 0.74 |
| TPSA | 142.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|