C11H12N4O4 — CID 122473852
(2S)-2-amino-3-(4-amino-7-nitro-1H-indol-3-yl)propanoic acid (PubChem CID 122473852) has the molecular formula C11H12N4O4 and a molecular weight of 264.24 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-amino-7-nitro-1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(4-amino-7-nitro-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 122473852 |
| Molecular Formula | C11H12N4O4 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | (2S)-2-amino-3-(4-amino-7-nitro-1H-indol-3-yl)propanoic acid |
| SMILES | Nc1ccc([N+](=O)[O-])c2[nH]cc(C[C@H](N)C(=O)O)c12 |
| InChI | InChI=1S/C11H12N4O4/c12-6-1-2-8(15(18)19)10-9(6)5(4-14-10)3-7(13)11(16)17/h1-2,4,7,14H,3,12-13H2,(H,16,17)/t7-/m0/s1 |
| InChIKey | QSHZBLBCFKOLSU-ZETCQYMHSA-N |
| XLogP | 0.61 |
| TPSA | 148.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|