C33H36N6O6S3 — CID 158641904
(2S)-2-amino-3-(7-methylsulfanyl-1H-indol-3-yl)propanoic acid;(2S)-2-amino-3-(7-methylsulfanyl-4-nitro-1H-indol-3-yl)propanoic acid;7-methylsulfanyl-1H-indole (PubChem CID 158641904) has the molecular formula C33H36N6O6S3 and a molecular weight of 708.89 g/mol. Its IUPAC name is (2S)-2-amino-3-(7-methylsulfanyl-1H-indol-3-yl)propanoic acid;(2S)-2-amino-3-(7-methylsulfanyl-4-nitro-1H-indol-3-yl)propanoic acid;7-methylsulfanyl-1H-indole.
| Compound Name | (2S)-2-amino-3-(7-methylsulfanyl-1H-indol-3-yl)propanoic acid;(2S)-2-amino-3-(7-methylsulfanyl-4-nitro-1H-indol-3-yl)propanoic acid;7-methylsulfanyl-1H-indole |
|---|---|
| PubChem CID | 158641904 |
| Molecular Formula | C33H36N6O6S3 |
| Molecular Weight | 708.89 g/mol |
| Exact Mass | 708.19 |
| IUPAC Name | (2S)-2-amino-3-(7-methylsulfanyl-1H-indol-3-yl)propanoic acid;(2S)-2-amino-3-(7-methylsulfanyl-4-nitro-1H-indol-3-yl)propanoic acid;7-methylsulfanyl-1H-indole |
| SMILES | CSc1ccc([N+](=O)[O-])c2c(C[C@H](N)C(=O)O)c[nH]c12.CSc1cccc2c(C[C@H](N)C(=O)O)c[nH]c12.CSc1cccc2cc[nH]c12 |
| InChI | InChI=1S/C12H13N3O4S.C12H14N2O2S.C9H9NS/c1-20-9-3-2-8(15(18)19)10-6(5-14-11(9)10)4-7(13)12(16)17;1-17-10-4-2-3-8-7(6-14-11(8)10)5-9(13)12(15)16;1-11-8-4-2-3-7-5-6-10-9(7)8/h2-3,5,7,14H,4,13H2,1H3,(H,16,17);2-4,6,9,14H,5,13H2,1H3,(H,15,16);2-6,10H,1H3/t7-;9-;/m00./s1 |
| InChIKey | IAMJOPNCUUFWQX-LKJYFVHXSA-N |
| XLogP | 6.49 |
| TPSA | 217.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.89 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|