C19H30N4O4 — CID 145142548
2-amino-3-[7-(dipropylamino)-4-nitro-1H-indol-3-yl]propanoic acid;ethane (PubChem CID 145142548) has the molecular formula C19H30N4O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-amino-3-[7-(dipropylamino)-4-nitro-1H-indol-3-yl]propanoic acid;ethane.
| Compound Name | 2-amino-3-[7-(dipropylamino)-4-nitro-1H-indol-3-yl]propanoic acid;ethane |
|---|---|
| PubChem CID | 145142548 |
| Molecular Formula | C19H30N4O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 2-amino-3-[7-(dipropylamino)-4-nitro-1H-indol-3-yl]propanoic acid;ethane |
| SMILES | CC.CCCN(CCC)c1ccc([N+](=O)[O-])c2c(CC(N)C(=O)O)c[nH]c12 |
| InChI | InChI=1S/C17H24N4O4.C2H6/c1-3-7-20(8-4-2)14-6-5-13(21(24)25)15-11(10-19-16(14)15)9-12(18)17(22)23;1-2/h5-6,10,12,19H,3-4,7-9,18H2,1-2H3,(H,22,23);1-2H3 |
| InChIKey | YDHPVTZSLKRXGU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 125.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|