C19H18ClN3O4 — CID 126574409
2-anilino-3-(4-chloro-1,2-dimethyl-7-nitroindol-3-yl)propanoic acid (PubChem CID 126574409) has the molecular formula C19H18ClN3O4 and a molecular weight of 387.82 g/mol. Its IUPAC name is 2-anilino-3-(4-chloro-1,2-dimethyl-7-nitroindol-3-yl)propanoic acid.
| Compound Name | 2-anilino-3-(4-chloro-1,2-dimethyl-7-nitroindol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 126574409 |
| Molecular Formula | C19H18ClN3O4 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 2-anilino-3-(4-chloro-1,2-dimethyl-7-nitroindol-3-yl)propanoic acid |
| SMILES | Cc1c(CC(Nc2ccccc2)C(=O)O)c2c(Cl)ccc([N+](=O)[O-])c2n1C |
| InChI | InChI=1S/C19H18ClN3O4/c1-11-13(10-15(19(24)25)21-12-6-4-3-5-7-12)17-14(20)8-9-16(23(26)27)18(17)22(11)2/h3-9,15,21H,10H2,1-2H3,(H,24,25) |
| InChIKey | HJVFCGKEDRJKNB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|