C16H18N2O4 — CID 153346450
3-(7-cyclopropyl-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid (PubChem CID 153346450) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 3-(7-cyclopropyl-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid.
| Compound Name | 3-(7-cyclopropyl-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 153346450 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 3-(7-cyclopropyl-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid |
| SMILES | Cc1c(CCC(=O)O)c2c([N+](=O)[O-])ccc(C3CC3)c2n1C |
| InChI | InChI=1S/C16H18N2O4/c1-9-11(6-8-14(19)20)15-13(18(21)22)7-5-12(10-3-4-10)16(15)17(9)2/h5,7,10H,3-4,6,8H2,1-2H3,(H,19,20) |
| InChIKey | FTGCEJGJKUFUJL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|