C12H12BrN3O4 — CID 122473702
2-amino-3-(5-bromo-2-methyl-4-nitro-1H-indol-3-yl)propanoic acid (PubChem CID 122473702) has the molecular formula C12H12BrN3O4 and a molecular weight of 342.15 g/mol. Its IUPAC name is 2-amino-3-(5-bromo-2-methyl-4-nitro-1H-indol-3-yl)propanoic acid.
| Compound Name | 2-amino-3-(5-bromo-2-methyl-4-nitro-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 122473702 |
| Molecular Formula | C12H12BrN3O4 |
| Molecular Weight | 342.15 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 2-amino-3-(5-bromo-2-methyl-4-nitro-1H-indol-3-yl)propanoic acid |
| SMILES | Cc1[nH]c2ccc(Br)c([N+](=O)[O-])c2c1CC(N)C(=O)O |
| InChI | InChI=1S/C12H12BrN3O4/c1-5-6(4-8(14)12(17)18)10-9(15-5)3-2-7(13)11(10)16(19)20/h2-3,8,15H,4,14H2,1H3,(H,17,18) |
| InChIKey | CZOYNQCOLPTHHC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 122.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.15 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|