C23H27N3 — CID 112539162
2,3-bis(1,2-dimethylindol-3-yl)propan-1-amine (PubChem CID 112539162) has the molecular formula C23H27N3 and a molecular weight of 345.49 g/mol. Its IUPAC name is 2,3-bis(1,2-dimethylindol-3-yl)propan-1-amine.
| Compound Name | 2,3-bis(1,2-dimethylindol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 112539162 |
| Molecular Formula | C23H27N3 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 2,3-bis(1,2-dimethylindol-3-yl)propan-1-amine |
| SMILES | Cc1c(CC(CN)c2c(C)n(C)c3ccccc23)c2ccccc2n1C |
| InChI | InChI=1S/C23H27N3/c1-15-20(18-9-5-7-11-21(18)25(15)3)13-17(14-24)23-16(2)26(4)22-12-8-6-10-19(22)23/h5-12,17H,13-14,24H2,1-4H3 |
| InChIKey | AEOALAIOLDNJNO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|