C20H24N2 — CID 83976752
2-(1,2-dimethylindol-3-yl)-3-(3-methylphenyl)propan-1-amine (PubChem CID 83976752) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 2-(1,2-dimethylindol-3-yl)-3-(3-methylphenyl)propan-1-amine.
| Compound Name | 2-(1,2-dimethylindol-3-yl)-3-(3-methylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 83976752 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-(1,2-dimethylindol-3-yl)-3-(3-methylphenyl)propan-1-amine |
| SMILES | Cc1cccc(CC(CN)c2c(C)n(C)c3ccccc23)c1 |
| InChI | InChI=1S/C20H24N2/c1-14-7-6-8-16(11-14)12-17(13-21)20-15(2)22(3)19-10-5-4-9-18(19)20/h4-11,17H,12-13,21H2,1-3H3 |
| InChIKey | GMIGCODLRWLDNF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|