C19H20Cl2N2 — CID 112539160
3-(2,3-dichlorophenyl)-2-(1,2-dimethylindol-3-yl)propan-1-amine (PubChem CID 112539160) has the molecular formula C19H20Cl2N2 and a molecular weight of 347.29 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-2-(1,2-dimethylindol-3-yl)propan-1-amine.
| Compound Name | 3-(2,3-dichlorophenyl)-2-(1,2-dimethylindol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 112539160 |
| Molecular Formula | C19H20Cl2N2 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-2-(1,2-dimethylindol-3-yl)propan-1-amine |
| SMILES | Cc1c(C(CN)Cc2cccc(Cl)c2Cl)c2ccccc2n1C |
| InChI | InChI=1S/C19H20Cl2N2/c1-12-18(15-7-3-4-9-17(15)23(12)2)14(11-22)10-13-6-5-8-16(20)19(13)21/h3-9,14H,10-11,22H2,1-2H3 |
| InChIKey | SEXYLGDRUCTSCT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|