C22H28N2O — CID 83976755
2-(1,2-dimethylindol-3-yl)-3-(3-propoxyphenyl)propan-1-amine (PubChem CID 83976755) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-(1,2-dimethylindol-3-yl)-3-(3-propoxyphenyl)propan-1-amine.
| Compound Name | 2-(1,2-dimethylindol-3-yl)-3-(3-propoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 83976755 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 2-(1,2-dimethylindol-3-yl)-3-(3-propoxyphenyl)propan-1-amine |
| SMILES | CCCOc1cccc(CC(CN)c2c(C)n(C)c3ccccc23)c1 |
| InChI | InChI=1S/C22H28N2O/c1-4-12-25-19-9-7-8-17(14-19)13-18(15-23)22-16(2)24(3)21-11-6-5-10-20(21)22/h5-11,14,18H,4,12-13,15,23H2,1-3H3 |
| InChIKey | QCCVDBCXSYFXIQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|