C19H23F2NO — CID 83975609
3-(3-butoxyphenyl)-2-(2,5-difluorophenyl)propan-1-amine (PubChem CID 83975609) has the molecular formula C19H23F2NO and a molecular weight of 319.40 g/mol. Its IUPAC name is 3-(3-butoxyphenyl)-2-(2,5-difluorophenyl)propan-1-amine.
| Compound Name | 3-(3-butoxyphenyl)-2-(2,5-difluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 83975609 |
| Molecular Formula | C19H23F2NO |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 3-(3-butoxyphenyl)-2-(2,5-difluorophenyl)propan-1-amine |
| SMILES | CCCCOc1cccc(CC(CN)c2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C19H23F2NO/c1-2-3-9-23-17-6-4-5-14(11-17)10-15(13-22)18-12-16(20)7-8-19(18)21/h4-8,11-12,15H,2-3,9-10,13,22H2,1H3 |
| InChIKey | WRKRCVMFKDGNEK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|