C20H26FNO2 — CID 83974775
2-(2-ethoxy-5-fluorophenyl)-3-(3-propan-2-yloxyphenyl)propan-1-amine (PubChem CID 83974775) has the molecular formula C20H26FNO2 and a molecular weight of 331.43 g/mol. Its IUPAC name is 2-(2-ethoxy-5-fluorophenyl)-3-(3-propan-2-yloxyphenyl)propan-1-amine.
| Compound Name | 2-(2-ethoxy-5-fluorophenyl)-3-(3-propan-2-yloxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 83974775 |
| Molecular Formula | C20H26FNO2 |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 2-(2-ethoxy-5-fluorophenyl)-3-(3-propan-2-yloxyphenyl)propan-1-amine |
| SMILES | CCOc1ccc(F)cc1C(CN)Cc1cccc(OC(C)C)c1 |
| InChI | InChI=1S/C20H26FNO2/c1-4-23-20-9-8-17(21)12-19(20)16(13-22)10-15-6-5-7-18(11-15)24-14(2)3/h5-9,11-12,14,16H,4,10,13,22H2,1-3H3 |
| InChIKey | VTMGRHZZCOTMKZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |