C19H24FNO2 — CID 83974772
2-(2-ethoxy-5-fluorophenyl)-3-(4-ethoxyphenyl)propan-1-amine (PubChem CID 83974772) has the molecular formula C19H24FNO2 and a molecular weight of 317.40 g/mol. Its IUPAC name is 2-(2-ethoxy-5-fluorophenyl)-3-(4-ethoxyphenyl)propan-1-amine.
| Compound Name | 2-(2-ethoxy-5-fluorophenyl)-3-(4-ethoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 83974772 |
| Molecular Formula | C19H24FNO2 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 2-(2-ethoxy-5-fluorophenyl)-3-(4-ethoxyphenyl)propan-1-amine |
| SMILES | CCOc1ccc(CC(CN)c2cc(F)ccc2OCC)cc1 |
| InChI | InChI=1S/C19H24FNO2/c1-3-22-17-8-5-14(6-9-17)11-15(13-21)18-12-16(20)7-10-19(18)23-4-2/h5-10,12,15H,3-4,11,13,21H2,1-2H3 |
| InChIKey | WYLAFLTZFGKLRK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |