C21H28FNO — CID 83975523
2-(2-fluorophenyl)-3-(4-hexoxyphenyl)propan-1-amine (PubChem CID 83975523) has the molecular formula C21H28FNO and a molecular weight of 329.46 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-3-(4-hexoxyphenyl)propan-1-amine.
| Compound Name | 2-(2-fluorophenyl)-3-(4-hexoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 83975523 |
| Molecular Formula | C21H28FNO |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | 2-(2-fluorophenyl)-3-(4-hexoxyphenyl)propan-1-amine |
| SMILES | CCCCCCOc1ccc(CC(CN)c2ccccc2F)cc1 |
| InChI | InChI=1S/C21H28FNO/c1-2-3-4-7-14-24-19-12-10-17(11-13-19)15-18(16-23)20-8-5-6-9-21(20)22/h5-6,8-13,18H,2-4,7,14-16,23H2,1H3 |
| InChIKey | UJCHJLLDNJJSAD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|