C19H23F2NO2 — CID 83975628
3-(2,3-diethoxyphenyl)-2-(2,5-difluorophenyl)propan-1-amine (PubChem CID 83975628) has the molecular formula C19H23F2NO2 and a molecular weight of 335.39 g/mol. Its IUPAC name is 3-(2,3-diethoxyphenyl)-2-(2,5-difluorophenyl)propan-1-amine.
| Compound Name | 3-(2,3-diethoxyphenyl)-2-(2,5-difluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 83975628 |
| Molecular Formula | C19H23F2NO2 |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 3-(2,3-diethoxyphenyl)-2-(2,5-difluorophenyl)propan-1-amine |
| SMILES | CCOc1cccc(CC(CN)c2cc(F)ccc2F)c1OCC |
| InChI | InChI=1S/C19H23F2NO2/c1-3-23-18-7-5-6-13(19(18)24-4-2)10-14(12-22)16-11-15(20)8-9-17(16)21/h5-9,11,14H,3-4,10,12,22H2,1-2H3 |
| InChIKey | HDOUHZDWHFEPPB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |