C20H26FNO3 — CID 112538879
2-(4-ethoxy-3-fluorophenyl)-3-(2-ethoxy-3-methoxyphenyl)propan-1-amine (PubChem CID 112538879) has the molecular formula C20H26FNO3 and a molecular weight of 347.43 g/mol. Its IUPAC name is 2-(4-ethoxy-3-fluorophenyl)-3-(2-ethoxy-3-methoxyphenyl)propan-1-amine.
| Compound Name | 2-(4-ethoxy-3-fluorophenyl)-3-(2-ethoxy-3-methoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 112538879 |
| Molecular Formula | C20H26FNO3 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 2-(4-ethoxy-3-fluorophenyl)-3-(2-ethoxy-3-methoxyphenyl)propan-1-amine |
| SMILES | CCOc1ccc(C(CN)Cc2cccc(OC)c2OCC)cc1F |
| InChI | InChI=1S/C20H26FNO3/c1-4-24-18-10-9-14(12-17(18)21)16(13-22)11-15-7-6-8-19(23-3)20(15)25-5-2/h6-10,12,16H,4-5,11,13,22H2,1-3H3 |
| InChIKey | SYKVCXZGMPUSLW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |