C12H16N2O — CID 95438701
(1R)-2-amino-1-(1,2-dimethylindol-3-yl)ethanol (PubChem CID 95438701) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is (1R)-2-amino-1-(1,2-dimethylindol-3-yl)ethanol.
| Compound Name | (1R)-2-amino-1-(1,2-dimethylindol-3-yl)ethanol |
|---|---|
| PubChem CID | 95438701 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (1R)-2-amino-1-(1,2-dimethylindol-3-yl)ethanol |
| SMILES | Cc1c([C@@H](O)CN)c2ccccc2n1C |
| InChI | InChI=1S/C12H16N2O/c1-8-12(11(15)7-13)9-5-3-4-6-10(9)14(8)2/h3-6,11,15H,7,13H2,1-2H3/t11-/m0/s1 |
| InChIKey | FWCPGUWGHHVIQP-NSHDSACASA-N |
| XLogP | 1.48 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|