C19H29N3O — CID 83976723
2-[4-[2-amino-1-(1,2-dimethylindol-3-yl)ethyl]piperidin-1-yl]ethanol (PubChem CID 83976723) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is 2-[4-[2-amino-1-(1,2-dimethylindol-3-yl)ethyl]piperidin-1-yl]ethanol.
| Compound Name | 2-[4-[2-amino-1-(1,2-dimethylindol-3-yl)ethyl]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 83976723 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | 2-[4-[2-amino-1-(1,2-dimethylindol-3-yl)ethyl]piperidin-1-yl]ethanol |
| SMILES | Cc1c(C(CN)C2CCN(CCO)CC2)c2ccccc2n1C |
| InChI | InChI=1S/C19H29N3O/c1-14-19(16-5-3-4-6-18(16)21(14)2)17(13-20)15-7-9-22(10-8-15)11-12-23/h3-6,15,17,23H,7-13,20H2,1-2H3 |
| InChIKey | QGQQFHUTRWVPCJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 54.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|