C18H18Cl2N2 — CID 83975787
2-(2,3-dichlorophenyl)-3-(1-methylindol-3-yl)propan-1-amine (PubChem CID 83975787) has the molecular formula C18H18Cl2N2 and a molecular weight of 333.26 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-3-(1-methylindol-3-yl)propan-1-amine.
| Compound Name | 2-(2,3-dichlorophenyl)-3-(1-methylindol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 83975787 |
| Molecular Formula | C18H18Cl2N2 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-3-(1-methylindol-3-yl)propan-1-amine |
| SMILES | Cn1cc(CC(CN)c2cccc(Cl)c2Cl)c2ccccc21 |
| InChI | InChI=1S/C18H18Cl2N2/c1-22-11-13(14-5-2-3-8-17(14)22)9-12(10-21)15-6-4-7-16(19)18(15)20/h2-8,11-12H,9-10,21H2,1H3 |
| InChIKey | VKHHFSVPIBCMND-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |