C18H18F2N2 — CID 83975209
2-(2,4-difluorophenyl)-3-(1-methylindol-3-yl)propan-1-amine (PubChem CID 83975209) has the molecular formula C18H18F2N2 and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-3-(1-methylindol-3-yl)propan-1-amine.
| Compound Name | 2-(2,4-difluorophenyl)-3-(1-methylindol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 83975209 |
| Molecular Formula | C18H18F2N2 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-(2,4-difluorophenyl)-3-(1-methylindol-3-yl)propan-1-amine |
| SMILES | Cn1cc(CC(CN)c2ccc(F)cc2F)c2ccccc21 |
| InChI | InChI=1S/C18H18F2N2/c1-22-11-13(16-4-2-3-5-18(16)22)8-12(10-21)15-7-6-14(19)9-17(15)20/h2-7,9,11-12H,8,10,21H2,1H3 |
| InChIKey | NIYUVQNSIYZRIC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |