C19H23F2N — CID 83975162
3-(4-tert-butylphenyl)-2-(2,4-difluorophenyl)propan-1-amine (PubChem CID 83975162) has the molecular formula C19H23F2N and a molecular weight of 303.40 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-2-(2,4-difluorophenyl)propan-1-amine.
| Compound Name | 3-(4-tert-butylphenyl)-2-(2,4-difluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 83975162 |
| Molecular Formula | C19H23F2N |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 3-(4-tert-butylphenyl)-2-(2,4-difluorophenyl)propan-1-amine |
| SMILES | CC(C)(C)c1ccc(CC(CN)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C19H23F2N/c1-19(2,3)15-6-4-13(5-7-15)10-14(12-22)17-9-8-16(20)11-18(17)21/h4-9,11,14H,10,12,22H2,1-3H3 |
| InChIKey | FZKYAWCNTLQYLX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |