C18H21F2NO3 — CID 83975169
2-(2,4-difluorophenyl)-3-(3,4,5-trimethoxyphenyl)propan-1-amine (PubChem CID 83975169) has the molecular formula C18H21F2NO3 and a molecular weight of 337.37 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-3-(3,4,5-trimethoxyphenyl)propan-1-amine.
| Compound Name | 2-(2,4-difluorophenyl)-3-(3,4,5-trimethoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 83975169 |
| Molecular Formula | C18H21F2NO3 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-(2,4-difluorophenyl)-3-(3,4,5-trimethoxyphenyl)propan-1-amine |
| SMILES | COc1cc(CC(CN)c2ccc(F)cc2F)cc(OC)c1OC |
| InChI | InChI=1S/C18H21F2NO3/c1-22-16-7-11(8-17(23-2)18(16)24-3)6-12(10-21)14-5-4-13(19)9-15(14)20/h4-5,7-9,12H,6,10,21H2,1-3H3 |
| InChIKey | JUAWQGCEZHJUJB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |