C19H21FN2O2 — CID 83976531
3-(3,4-dimethoxyphenyl)-2-(5-fluoro-1H-indol-3-yl)propan-1-amine (PubChem CID 83976531) has the molecular formula C19H21FN2O2 and a molecular weight of 328.39 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-2-(5-fluoro-1H-indol-3-yl)propan-1-amine.
| Compound Name | 3-(3,4-dimethoxyphenyl)-2-(5-fluoro-1H-indol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 83976531 |
| Molecular Formula | C19H21FN2O2 |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-2-(5-fluoro-1H-indol-3-yl)propan-1-amine |
| SMILES | COc1ccc(CC(CN)c2c[nH]c3ccc(F)cc23)cc1OC |
| InChI | InChI=1S/C19H21FN2O2/c1-23-18-6-3-12(8-19(18)24-2)7-13(10-21)16-11-22-17-5-4-14(20)9-15(16)17/h3-6,8-9,11,13,22H,7,10,21H2,1-2H3 |
| InChIKey | NMVZQZHPAUIRTI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |