C19H20ClFN2 — CID 83976734
3-(2-chloro-6-fluorophenyl)-2-(1,2-dimethylindol-3-yl)propan-1-amine (PubChem CID 83976734) has the molecular formula C19H20ClFN2 and a molecular weight of 330.83 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-2-(1,2-dimethylindol-3-yl)propan-1-amine.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-2-(1,2-dimethylindol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 83976734 |
| Molecular Formula | C19H20ClFN2 |
| Molecular Weight | 330.83 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-2-(1,2-dimethylindol-3-yl)propan-1-amine |
| SMILES | Cc1c(C(CN)Cc2c(F)cccc2Cl)c2ccccc2n1C |
| InChI | InChI=1S/C19H20ClFN2/c1-12-19(14-6-3-4-9-18(14)23(12)2)13(11-22)10-15-16(20)7-5-8-17(15)21/h3-9,13H,10-11,22H2,1-2H3 |
| InChIKey | HPMJZNXJXKRHRG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.83 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|