C20H24N2 — CID 83976905
2-(1-ethylindol-3-yl)-3-(3-methylphenyl)propan-1-amine (PubChem CID 83976905) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 2-(1-ethylindol-3-yl)-3-(3-methylphenyl)propan-1-amine.
| Compound Name | 2-(1-ethylindol-3-yl)-3-(3-methylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 83976905 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-(1-ethylindol-3-yl)-3-(3-methylphenyl)propan-1-amine |
| SMILES | CCn1cc(C(CN)Cc2cccc(C)c2)c2ccccc21 |
| InChI | InChI=1S/C20H24N2/c1-3-22-14-19(18-9-4-5-10-20(18)22)17(13-21)12-16-8-6-7-15(2)11-16/h4-11,14,17H,3,12-13,21H2,1-2H3 |
| InChIKey | ABTSHARQYSKJJP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |