C16H18N2S — CID 83987665
2-(1-ethylindol-3-yl)-2-thiophen-2-ylethanamine (PubChem CID 83987665) has the molecular formula C16H18N2S and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-(1-ethylindol-3-yl)-2-thiophen-2-ylethanamine.
| Compound Name | 2-(1-ethylindol-3-yl)-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 83987665 |
| Molecular Formula | C16H18N2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-(1-ethylindol-3-yl)-2-thiophen-2-ylethanamine |
| SMILES | CCn1cc(C(CN)c2cccs2)c2ccccc21 |
| InChI | InChI=1S/C16H18N2S/c1-2-18-11-14(12-6-3-4-7-15(12)18)13(10-17)16-8-5-9-19-16/h3-9,11,13H,2,10,17H2,1H3 |
| InChIKey | YOFVBIAAQPRJSY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |