C19H29N3 — CID 83976864
2-(1-ethylindol-3-yl)-2-(1-ethylpiperidin-4-yl)ethanamine (PubChem CID 83976864) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is 2-(1-ethylindol-3-yl)-2-(1-ethylpiperidin-4-yl)ethanamine.
| Compound Name | 2-(1-ethylindol-3-yl)-2-(1-ethylpiperidin-4-yl)ethanamine |
|---|---|
| PubChem CID | 83976864 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 2-(1-ethylindol-3-yl)-2-(1-ethylpiperidin-4-yl)ethanamine |
| SMILES | CCN1CCC(C(CN)c2cn(CC)c3ccccc23)CC1 |
| InChI | InChI=1S/C19H29N3/c1-3-21-11-9-15(10-12-21)17(13-20)18-14-22(4-2)19-8-6-5-7-16(18)19/h5-8,14-15,17H,3-4,9-13,20H2,1-2H3 |
| InChIKey | NZLFAVWLJJSYNW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 34.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |