C14H18N2O2 — CID 145142348
3-(2-amino-3-hydroxybut-3-enyl)-1,2-dimethylindol-4-ol (PubChem CID 145142348) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-(2-amino-3-hydroxybut-3-enyl)-1,2-dimethylindol-4-ol.
| Compound Name | 3-(2-amino-3-hydroxybut-3-enyl)-1,2-dimethylindol-4-ol |
|---|---|
| PubChem CID | 145142348 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 3-(2-amino-3-hydroxybut-3-enyl)-1,2-dimethylindol-4-ol |
| SMILES | C=C(O)C(N)Cc1c(C)n(C)c2cccc(O)c12 |
| InChI | InChI=1S/C14H18N2O2/c1-8-10(7-11(15)9(2)17)14-12(16(8)3)5-4-6-13(14)18/h4-6,11,17-18H,2,7,15H2,1,3H3 |
| InChIKey | ZNTPEFJALOIVLT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|