C13H19NO5 — CID 54846591
2-amino-3-[3-methoxy-2-(2-methoxyethoxy)phenyl]propanoic acid (PubChem CID 54846591) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-amino-3-[3-methoxy-2-(2-methoxyethoxy)phenyl]propanoic acid.
| Compound Name | 2-amino-3-[3-methoxy-2-(2-methoxyethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 54846591 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-amino-3-[3-methoxy-2-(2-methoxyethoxy)phenyl]propanoic acid |
| SMILES | COCCOc1c(CC(N)C(=O)O)cccc1OC |
| InChI | InChI=1S/C13H19NO5/c1-17-6-7-19-12-9(8-10(14)13(15)16)4-3-5-11(12)18-2/h3-5,10H,6-8,14H2,1-2H3,(H,15,16) |
| InChIKey | KTFBLGMXPDHNAD-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|