2-amino-3-[3,4-dimethoxy-2-(methoxymethyl)phenyl]propanoic acid

C13H19NO5 — CID 117426358

IUPAC2-amino-3-[3,4-dimethoxy-2-(methoxymethyl)phenyl]propanoic acid
SMILESCOCc1c(CC(N)C(=O)O)ccc(OC)c1OC
InChIInChI=1S/C13H19NO5/c1-17-7-9-8(6-10(14)13(15)16)4-5-11(18-2)12(9)19-3/h4-5,10H,6-7,14H2,1-3H3,(H,15,16)
InChIKeyIEVHCEABFCCKCD-UHFFFAOYSA-N
MW269.30 g/mol
LogP0.80
Rot. Bonds7

About 2-amino-3-[3,4-dimethoxy-2-(methoxymethyl)phenyl]propanoic acid

2-amino-3-[3,4-dimethoxy-2-(methoxymethyl)phenyl]propanoic acid (PubChem CID 117426358) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-amino-3-[3,4-dimethoxy-2-(methoxymethyl)phenyl]propanoic acid.

Molecular Properties

Compound Name2-amino-3-[3,4-dimethoxy-2-(methoxymethyl)phenyl]propanoic acid
PubChem CID117426358
Molecular FormulaC13H19NO5
Molecular Weight269.30 g/mol
Exact Mass269.13
IUPAC Name2-amino-3-[3,4-dimethoxy-2-(methoxymethyl)phenyl]propanoic acid
SMILESCOCc1c(CC(N)C(=O)O)ccc(OC)c1OC
InChIInChI=1S/C13H19NO5/c1-17-7-9-8(6-10(14)13(15)16)4-5-11(18-2)12(9)19-3/h4-5,10H,6-7,14H2,1-3H3,(H,15,16)
InChIKeyIEVHCEABFCCKCD-UHFFFAOYSA-N
XLogP0.80
TPSA91.01 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.30
LogP ≤ 50.80
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-amino-3-[3,4-dimethoxy-2-(methoxymethyl)phenyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-[3,4-dimethoxy-2-(methoxymethyl)phenyl]propanoic acid?
The IUPAC name of 2-amino-3-[3,4-dimethoxy-2-(methoxymethyl)phenyl]propanoic acid (CID 117426358) is 2-amino-3-[3,4-dimethoxy-2-(methoxymethyl)phenyl]propanoic acid.
What is the SMILES notation for 2-amino-3-[3,4-dimethoxy-2-(methoxymethyl)phenyl]propanoic acid?
The canonical SMILES for 2-amino-3-[3,4-dimethoxy-2-(methoxymethyl)phenyl]propanoic acid is COCc1c(CC(N)C(=O)O)ccc(OC)c1OC.
What is the InChIKey of 2-amino-3-[3,4-dimethoxy-2-(methoxymethyl)phenyl]propanoic acid?
The InChIKey is IEVHCEABFCCKCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO5/c1-17-7-9-8(6-10(14)13(15)16)4-5-11(18-2)12(9)19-3/h4-5,10H,6-7,14H2,1-3H3,(H,15,16).
What are the key properties of 2-amino-3-[3,4-dimethoxy-2-(methoxymethyl)phenyl]propanoic acid?
2-amino-3-[3,4-dimethoxy-2-(methoxymethyl)phenyl]propanoic acid has a molecular weight of 269.30 g/mol, XLogP of 0.80, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[3,4-dimethoxy-2-(methoxymethyl)phenyl]propanoic acid is sourced from PubChem (CID 117426358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).