C31H35N3 — CID 22332437
4-[bis(7-ethyl-1H-indol-3-yl)methyl]-N,N-diethylaniline (PubChem CID 22332437) has the molecular formula C31H35N3 and a molecular weight of 449.64 g/mol. Its IUPAC name is 4-[bis(7-ethyl-1H-indol-3-yl)methyl]-N,N-diethylaniline.
| Compound Name | 4-[bis(7-ethyl-1H-indol-3-yl)methyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 22332437 |
| Molecular Formula | C31H35N3 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | 4-[bis(7-ethyl-1H-indol-3-yl)methyl]-N,N-diethylaniline |
| SMILES | CCc1cccc2c(C(c3ccc(N(CC)CC)cc3)c3c[nH]c4c(CC)cccc34)c[nH]c12 |
| InChI | InChI=1S/C31H35N3/c1-5-21-11-9-13-25-27(19-32-30(21)25)29(23-15-17-24(18-16-23)34(7-3)8-4)28-20-33-31-22(6-2)12-10-14-26(28)31/h9-20,29,32-33H,5-8H2,1-4H3 |
| InChIKey | PRVMYXHNAMCAGW-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 34.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |