C15H18ClNO2 — CID 98035172
4-(7-chloro-4-methoxy-1,2-dimethylindol-3-yl)butan-2-one (PubChem CID 98035172) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is 4-(7-chloro-4-methoxy-1,2-dimethylindol-3-yl)butan-2-one.
| Compound Name | 4-(7-chloro-4-methoxy-1,2-dimethylindol-3-yl)butan-2-one |
|---|---|
| PubChem CID | 98035172 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 4-(7-chloro-4-methoxy-1,2-dimethylindol-3-yl)butan-2-one |
| SMILES | COc1ccc(Cl)c2c1c(CCC(C)=O)c(C)n2C |
| InChI | InChI=1S/C15H18ClNO2/c1-9(18)5-6-11-10(2)17(3)15-12(16)7-8-13(19-4)14(11)15/h7-8H,5-6H2,1-4H3 |
| InChIKey | IEYITYXSPKNYFP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |