C14H17NO2 — CID 82495458
1-(7-methoxy-1,2,4-trimethylindol-3-yl)ethanone (PubChem CID 82495458) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is 1-(7-methoxy-1,2,4-trimethylindol-3-yl)ethanone.
| Compound Name | 1-(7-methoxy-1,2,4-trimethylindol-3-yl)ethanone |
|---|---|
| PubChem CID | 82495458 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 1-(7-methoxy-1,2,4-trimethylindol-3-yl)ethanone |
| SMILES | COc1ccc(C)c2c(C(C)=O)c(C)n(C)c12 |
| InChI | InChI=1S/C14H17NO2/c1-8-6-7-11(17-5)14-12(8)13(10(3)16)9(2)15(14)4/h6-7H,1-5H3 |
| InChIKey | PXXCHGCZRIZBCX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |