C13H14ClNO2 — CID 82499395
1-(7-chloro-4-methoxy-1,2-dimethylindol-3-yl)ethanone (PubChem CID 82499395) has the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. Its IUPAC name is 1-(7-chloro-4-methoxy-1,2-dimethylindol-3-yl)ethanone.
| Compound Name | 1-(7-chloro-4-methoxy-1,2-dimethylindol-3-yl)ethanone |
|---|---|
| PubChem CID | 82499395 |
| Molecular Formula | C13H14ClNO2 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 1-(7-chloro-4-methoxy-1,2-dimethylindol-3-yl)ethanone |
| SMILES | COc1ccc(Cl)c2c1c(C(C)=O)c(C)n2C |
| InChI | InChI=1S/C13H14ClNO2/c1-7-11(8(2)16)12-10(17-4)6-5-9(14)13(12)15(7)3/h5-6H,1-4H3 |
| InChIKey | YIFMJOFXSDVRCM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |