C21H26FNO6 — CID 145226825
ethyl 3-[1,3-bis(2-ethoxy-2-oxoethyl)-7-fluoroindol-2-yl]propanoate (PubChem CID 145226825) has the molecular formula C21H26FNO6 and a molecular weight of 407.44 g/mol. Its IUPAC name is ethyl 3-[1,3-bis(2-ethoxy-2-oxoethyl)-7-fluoroindol-2-yl]propanoate.
| Compound Name | ethyl 3-[1,3-bis(2-ethoxy-2-oxoethyl)-7-fluoroindol-2-yl]propanoate |
|---|---|
| PubChem CID | 145226825 |
| Molecular Formula | C21H26FNO6 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | ethyl 3-[1,3-bis(2-ethoxy-2-oxoethyl)-7-fluoroindol-2-yl]propanoate |
| SMILES | CCOC(=O)CCc1c(CC(=O)OCC)c2cccc(F)c2n1CC(=O)OCC |
| InChI | InChI=1S/C21H26FNO6/c1-4-27-18(24)11-10-17-15(12-19(25)28-5-2)14-8-7-9-16(22)21(14)23(17)13-20(26)29-6-3/h7-9H,4-6,10-13H2,1-3H3 |
| InChIKey | FWADVZQYCQCQNJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|