C17H20BrFN2O2 — CID 71552751
ethyl 2-[7-fluoro-3-(pyrrolidin-1-ium-1-ylidenemethyl)indol-1-yl]acetate bromide (PubChem CID 71552751) has the molecular formula C17H20BrFN2O2 and a molecular weight of 383.26 g/mol. Its IUPAC name is ethyl 2-[7-fluoro-3-(pyrrolidin-1-ium-1-ylidenemethyl)indol-1-yl]acetate bromide.
| Compound Name | ethyl 2-[7-fluoro-3-(pyrrolidin-1-ium-1-ylidenemethyl)indol-1-yl]acetate bromide |
|---|---|
| PubChem CID | 71552751 |
| Molecular Formula | C17H20BrFN2O2 |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | ethyl 2-[7-fluoro-3-(pyrrolidin-1-ium-1-ylidenemethyl)indol-1-yl]acetate bromide |
| SMILES | CCOC(=O)Cn1cc(C=[N+]2CCCC2)c2cccc(F)c21.[Br-] |
| InChI | InChI=1S/C17H20FN2O2.BrH/c1-2-22-16(21)12-20-11-13(10-19-8-3-4-9-19)14-6-5-7-15(18)17(14)20;/h5-7,10-11H,2-4,8-9,12H2,1H3;1H/q+1;/p-1 |
| InChIKey | XXEWAZJSNXPSHR-UHFFFAOYSA-M |
| XLogP | -0.43 |
| TPSA | 34.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|