C15H14FNO4 — CID 71624259
ethyl 8-fluoro-1-(oxiran-2-ylmethyl)-4-oxoquinoline-3-carboxylate (PubChem CID 71624259) has the molecular formula C15H14FNO4 and a molecular weight of 291.28 g/mol. Its IUPAC name is ethyl 8-fluoro-1-(oxiran-2-ylmethyl)-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 8-fluoro-1-(oxiran-2-ylmethyl)-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 71624259 |
| Molecular Formula | C15H14FNO4 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | ethyl 8-fluoro-1-(oxiran-2-ylmethyl)-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(CC2CO2)c2c(F)cccc2c1=O |
| InChI | InChI=1S/C15H14FNO4/c1-2-20-15(19)11-7-17(6-9-8-21-9)13-10(14(11)18)4-3-5-12(13)16/h3-5,7,9H,2,6,8H2,1H3 |
| InChIKey | ACZNVLRBCVZREA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 60.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|