C16H18FNO4 — CID 118643323
ethyl 1-(3-fluoropropyl)-8-methoxy-4-oxoquinoline-3-carboxylate (PubChem CID 118643323) has the molecular formula C16H18FNO4 and a molecular weight of 307.32 g/mol. Its IUPAC name is ethyl 1-(3-fluoropropyl)-8-methoxy-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-(3-fluoropropyl)-8-methoxy-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 118643323 |
| Molecular Formula | C16H18FNO4 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | ethyl 1-(3-fluoropropyl)-8-methoxy-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(CCCF)c2c(OC)cccc2c1=O |
| InChI | InChI=1S/C16H18FNO4/c1-3-22-16(20)12-10-18(9-5-8-17)14-11(15(12)19)6-4-7-13(14)21-2/h4,6-7,10H,3,5,8-9H2,1-2H3 |
| InChIKey | WQAAIDWWAJBVJS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |