C27H28N2O10 — CID 159602543
ethyl 1-ethyl-7,8-dihydroxy-4-oxoquinoline-3-carboxylate;methyl 1-ethyl-7,8-dihydroxy-4-oxoquinoline-3-carboxylate (PubChem CID 159602543) has the molecular formula C27H28N2O10 and a molecular weight of 540.53 g/mol. Its IUPAC name is ethyl 1-ethyl-7,8-dihydroxy-4-oxoquinoline-3-carboxylate;methyl 1-ethyl-7,8-dihydroxy-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-ethyl-7,8-dihydroxy-4-oxoquinoline-3-carboxylate;methyl 1-ethyl-7,8-dihydroxy-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 159602543 |
| Molecular Formula | C27H28N2O10 |
| Molecular Weight | 540.53 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | ethyl 1-ethyl-7,8-dihydroxy-4-oxoquinoline-3-carboxylate;methyl 1-ethyl-7,8-dihydroxy-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(CC)c2c(O)c(O)ccc2c1=O.CCn1cc(C(=O)OC)c(=O)c2ccc(O)c(O)c21 |
| InChI | InChI=1S/C14H15NO5.C13H13NO5/c1-3-15-7-9(14(19)20-4-2)12(17)8-5-6-10(16)13(18)11(8)15;1-3-14-6-8(13(18)19-2)11(16)7-4-5-9(15)12(17)10(7)14/h5-7,16,18H,3-4H2,1-2H3;4-6,15,17H,3H2,1-2H3 |
| InChIKey | MLRASRWGRQHJHB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 177.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|