C14H15NO5 — CID 86732826
ethyl 1-ethyl-5,6-dihydroxy-4-oxoquinoline-3-carboxylate (PubChem CID 86732826) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is ethyl 1-ethyl-5,6-dihydroxy-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-ethyl-5,6-dihydroxy-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 86732826 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | ethyl 1-ethyl-5,6-dihydroxy-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(CC)c2ccc(O)c(O)c2c1=O |
| InChI | InChI=1S/C14H15NO5/c1-3-15-7-8(14(19)20-4-2)12(17)11-9(15)5-6-10(16)13(11)18/h5-7,16,18H,3-4H2,1-2H3 |
| InChIKey | JOUFGSMSDCYAPM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|